C17H22N4O2 — CID 133333792
2-N-(dicyclopropylmethyl)-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 133333792) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-N-(dicyclopropylmethyl)-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 2-N-(dicyclopropylmethyl)-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 133333792 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-N-(dicyclopropylmethyl)-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(NC(C3CC3)C3CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C17H22N4O2/c1-22-13-7-11-12(8-14(13)23-2)19-17(21-16(11)18)20-15(9-3-4-9)10-5-6-10/h7-10,15H,3-6H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | DNWMWQVOSGVQTC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |