C22H27N5O3 — CID 166201680
6,7-dimethoxy-2-N-[1-(3-methoxyphenyl)piperidin-4-yl]quinazoline-2,4-diamine (PubChem CID 166201680) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-[1-(3-methoxyphenyl)piperidin-4-yl]quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-[1-(3-methoxyphenyl)piperidin-4-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 166201680 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 6,7-dimethoxy-2-N-[1-(3-methoxyphenyl)piperidin-4-yl]quinazoline-2,4-diamine |
| SMILES | COc1cccc(N2CCC(Nc3nc(N)c4cc(OC)c(OC)cc4n3)CC2)c1 |
| InChI | InChI=1S/C22H27N5O3/c1-28-16-6-4-5-15(11-16)27-9-7-14(8-10-27)24-22-25-18-13-20(30-3)19(29-2)12-17(18)21(23)26-22/h4-6,11-14H,7-10H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | QJZSRNOVWOIIOJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |