C16H19N7O2 — CID 131963482
6,7-dimethoxy-2-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinazoline-2,4-diamine (PubChem CID 131963482) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 131963482 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 6,7-dimethoxy-2-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(NC3CCc4ncnn4C3)nc(N)c2cc1OC |
| InChI | InChI=1S/C16H19N7O2/c1-24-12-5-10-11(6-13(12)25-2)21-16(22-15(10)17)20-9-3-4-14-18-8-19-23(14)7-9/h5-6,8-9H,3-4,7H2,1-2H3,(H3,17,20,21,22) |
| InChIKey | KKTJKAXPEOCVMJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |