C14H16N6O2 — CID 117094579
6,7-dimethoxy-2-N-(2-methylpyrazol-3-yl)quinazoline-2,4-diamine (PubChem CID 117094579) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-(2-methylpyrazol-3-yl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-(2-methylpyrazol-3-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 117094579 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6,7-dimethoxy-2-N-(2-methylpyrazol-3-yl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3ccnn3C)nc(N)c2cc1OC |
| InChI | InChI=1S/C14H16N6O2/c1-20-12(4-5-16-20)18-14-17-9-7-11(22-3)10(21-2)6-8(9)13(15)19-14/h4-7H,1-3H3,(H3,15,17,18,19) |
| InChIKey | DKJYGXUJHSXGCT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |