C32H29N5O2 — CID 161345385
N-benzyl-2-[2-[4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide;methane (PubChem CID 161345385) has the molecular formula C32H29N5O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is N-benzyl-2-[2-[4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide;methane.
| Compound Name | N-benzyl-2-[2-[4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide;methane |
|---|---|
| PubChem CID | 161345385 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-benzyl-2-[2-[4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenoxy]acetamide;methane |
| SMILES | C.O=C(COc1ccccc1-c1nc(Nc2ccc3c(c2)C=NC3)c2ccccc2n1)NCc1ccccc1 |
| InChI | InChI=1S/C31H25N5O2.CH4/c37-29(33-17-21-8-2-1-3-9-21)20-38-28-13-7-5-11-26(28)31-35-27-12-6-4-10-25(27)30(36-31)34-24-15-14-22-18-32-19-23(22)16-24;/h1-16,19H,17-18,20H2,(H,33,37)(H,34,35,36);1H4 |
| InChIKey | VNFKGDFSNZSFDL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |