C20H17N7O — CID 117079410
N-(1H-benzimidazol-2-ylmethyl)-2-(4-methoxyphenyl)-7H-purin-6-amine (PubChem CID 117079410) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-(4-methoxyphenyl)-7H-purin-6-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-(4-methoxyphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117079410 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-(4-methoxyphenyl)-7H-purin-6-amine |
| SMILES | COc1ccc(-c2nc(NCc3nc4ccccc4[nH]3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C20H17N7O/c1-28-13-8-6-12(7-9-13)18-26-19(17-20(27-18)23-11-22-17)21-10-16-24-14-4-2-3-5-15(14)25-16/h2-9,11H,10H2,1H3,(H,24,25)(H2,21,22,23,26,27) |
| InChIKey | BXYKMALWHVBTAU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |