C19H22N8O — CID 117093287
4-[[6-(1H-benzimidazol-2-ylmethylamino)-7H-purin-8-yl]amino]cyclohexan-1-ol (PubChem CID 117093287) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[[6-(1H-benzimidazol-2-ylmethylamino)-7H-purin-8-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(1H-benzimidazol-2-ylmethylamino)-7H-purin-8-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 117093287 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[[6-(1H-benzimidazol-2-ylmethylamino)-7H-purin-8-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2nc3ncnc(NCc4nc5ccccc5[nH]4)c3[nH]2)CC1 |
| InChI | InChI=1S/C19H22N8O/c28-12-7-5-11(6-8-12)23-19-26-16-17(21-10-22-18(16)27-19)20-9-15-24-13-3-1-2-4-14(13)25-15/h1-4,10-12,28H,5-9H2,(H,24,25)(H3,20,21,22,23,26,27) |
| InChIKey | QBQWBWHYFHFHJL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |