C25H30N10O5 — CID 67324836
N-(furan-2-ylmethyl)-7H-purin-6-amine;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 67324836) has the molecular formula C25H30N10O5 and a molecular weight of 550.58 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-7H-purin-6-amine;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67324836 |
| Molecular Formula | C25H30N10O5 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.c1coc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C15H21N5O4.C10H9N5O/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15;1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18);1-3,5-6H,4H2,(H2,11,12,13,14,15)/t9-,11-,12-,15-;/m1./s1 |
| InChIKey | YCZRGUHMUJOUDQ-DNBRLMRSSA-N |
| XLogP | 1.37 |
| TPSA | 205.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|