C10H9N5O — CID 162654166
N-(furan-2-ylmethyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 162654166) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-(furan-2-ylmethyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162654166 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | c1coc(CNc2ncnc3cn[nH]c23)c1 |
| InChI | InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-10-9-8(5-14-15-9)12-6-13-10/h1-3,5-6H,4H2,(H,14,15)(H,11,12,13) |
| InChIKey | CGUFPCBAWFDACN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |