C10H12N4O — CID 80766445
4-N-(furan-2-ylmethyl)-5-methylpyrimidine-4,6-diamine (PubChem CID 80766445) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-5-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(furan-2-ylmethyl)-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80766445 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-5-methylpyrimidine-4,6-diamine |
| SMILES | Cc1c(N)ncnc1NCc1ccco1 |
| InChI | InChI=1S/C10H12N4O/c1-7-9(11)13-6-14-10(7)12-5-8-3-2-4-15-8/h2-4,6H,5H2,1H3,(H3,11,12,13,14) |
| InChIKey | HBHFSFNYXLGCKM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |