C15H15N5O — CID 19146076
6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,5,6-triamine (PubChem CID 19146076) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19146076 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCc2ccco2)ncnc1Nc1ccccc1 |
| InChI | InChI=1S/C15H15N5O/c16-13-14(17-9-12-7-4-8-21-12)18-10-19-15(13)20-11-5-2-1-3-6-11/h1-8,10H,9,16H2,(H2,17,18,19,20) |
| InChIKey | OECHHNSGMUYUQL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |