C10H11N3O2 — CID 80858744
6-(furan-2-ylmethoxy)-5-methylpyrimidin-4-amine (PubChem CID 80858744) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 6-(furan-2-ylmethoxy)-5-methylpyrimidin-4-amine.
| Compound Name | 6-(furan-2-ylmethoxy)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80858744 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 6-(furan-2-ylmethoxy)-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(N)ncnc1OCc1ccco1 |
| InChI | InChI=1S/C10H11N3O2/c1-7-9(11)12-6-13-10(7)15-5-8-3-2-4-14-8/h2-4,6H,5H2,1H3,(H2,11,12,13) |
| InChIKey | BTUQSNPFBWSGOP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |