C10H8Cl2N2O2 — CID 102760408
3,5-dichloro-6-(furan-2-ylmethoxy)pyridin-2-amine (PubChem CID 102760408) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is 3,5-dichloro-6-(furan-2-ylmethoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(furan-2-ylmethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760408 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3,5-dichloro-6-(furan-2-ylmethoxy)pyridin-2-amine |
| SMILES | Nc1nc(OCc2ccco2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O2/c11-7-4-8(12)10(14-9(7)13)16-5-6-2-1-3-15-6/h1-4H,5H2,(H2,13,14) |
| InChIKey | VIOVQBOAAPBPIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |