C10H12N4O3 — CID 80859367
4-ethoxy-6-(furan-2-ylmethoxy)-1,3,5-triazin-2-amine (PubChem CID 80859367) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-ethoxy-6-(furan-2-ylmethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(furan-2-ylmethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80859367 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4-ethoxy-6-(furan-2-ylmethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(OCc2ccco2)n1 |
| InChI | InChI=1S/C10H12N4O3/c1-2-15-9-12-8(11)13-10(14-9)17-6-7-4-3-5-16-7/h3-5H,2,6H2,1H3,(H2,11,12,13,14) |
| InChIKey | CVLABRCOTSBJQY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |