About ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen
ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen (PubChem CID 158085182) has the molecular formula C17H22O7Si
and a molecular weight of 366.44 g/mol. Its IUPAC name is ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen |
| PubChem CID | 158085182 |
| Molecular Formula | C17H22O7Si |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen |
| SMILES | CCO[Si](OCc1ccco1)(OCc1ccco1)OCc1ccco1.[H][H] |
| InChI | InChI=1S/C17H20O7Si.H2/c1-2-21-25(22-12-15-6-3-9-18-15,23-13-16-7-4-10-19-16)24-14-17-8-5-11-20-17;/h3-11H,2,12-14H2,1H3;1H |
| InChIKey | FNKUMDXFZBDRDL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen?
The IUPAC name of ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen (CID 158085182) is ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen.
What is the SMILES notation for ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen?
The canonical SMILES for ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen is CCO[Si](OCc1ccco1)(OCc1ccco1)OCc1ccco1.[H][H].
What is the InChIKey of ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen?
The InChIKey is FNKUMDXFZBDRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O7Si.H2/c1-2-21-25(22-12-15-6-3-9-18-15,23-13-16-7-4-10-19-16)24-14-17-8-5-11-20-17;/h3-11H,2,12-14H2,1H3;1H.
What are the key properties of ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen?
ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen has a molecular weight of 366.44 g/mol, XLogP of 4.13, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl tris(furan-2-ylmethyl) silicate;molecular hydrogen is sourced from PubChem (CID 158085182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).