C8H12O4 — CID 69117104
(1R)-1-(furan-2-ylmethoxy)propane-1,2-diol (PubChem CID 69117104) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (1R)-1-(furan-2-ylmethoxy)propane-1,2-diol.
| Compound Name | (1R)-1-(furan-2-ylmethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 69117104 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1R)-1-(furan-2-ylmethoxy)propane-1,2-diol |
| SMILES | CC(O)[C@H](O)OCc1ccco1 |
| InChI | InChI=1S/C8H12O4/c1-6(9)8(10)12-5-7-3-2-4-11-7/h2-4,6,8-10H,5H2,1H3/t6?,8-/m1/s1 |
| InChIKey | YDBCIBJZBJDXMK-QFSRMBNQSA-N |
| XLogP | 0.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|