C11H14N4O2 — CID 80858205
4-N-ethyl-6-(furan-2-ylmethoxy)pyrimidine-2,4-diamine (PubChem CID 80858205) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-N-ethyl-6-(furan-2-ylmethoxy)pyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-(furan-2-ylmethoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80858205 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4-N-ethyl-6-(furan-2-ylmethoxy)pyrimidine-2,4-diamine |
| SMILES | CCNc1cc(OCc2ccco2)nc(N)n1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-13-9-6-10(15-11(12)14-9)17-7-8-4-3-5-16-8/h3-6H,2,7H2,1H3,(H3,12,13,14,15) |
| InChIKey | DYNBLPGPLJGSCR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |