C11H12ClN3O2 — CID 58039750
2-chloro-4-ethoxy-6-[2-(furan-2-yl)ethyl]-1,3,5-triazine (PubChem CID 58039750) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-[2-(furan-2-yl)ethyl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-[2-(furan-2-yl)ethyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58039750 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-chloro-4-ethoxy-6-[2-(furan-2-yl)ethyl]-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(CCc2ccco2)n1 |
| InChI | InChI=1S/C11H12ClN3O2/c1-2-16-11-14-9(13-10(12)15-11)6-5-8-4-3-7-17-8/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | DZJPBJUQGHHHAN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |