C8H6Cl2N2O — CID 102760352
3,5-dichloro-6-prop-2-ynoxypyridin-2-amine (PubChem CID 102760352) has the molecular formula C8H6Cl2N2O and a molecular weight of 217.06 g/mol. Its IUPAC name is 3,5-dichloro-6-prop-2-ynoxypyridin-2-amine.
| Compound Name | 3,5-dichloro-6-prop-2-ynoxypyridin-2-amine |
|---|---|
| PubChem CID | 102760352 |
| Molecular Formula | C8H6Cl2N2O |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 3,5-dichloro-6-prop-2-ynoxypyridin-2-amine |
| SMILES | C#CCOc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2N2O/c1-2-3-13-8-6(10)4-5(9)7(11)12-8/h1,4H,3H2,(H2,11,12) |
| InChIKey | WTVYYXAQWISXMX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|