C9H9Cl3N2O3 — CID 54333779
2-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]ethyl 2-chloroacetate (PubChem CID 54333779) has the molecular formula C9H9Cl3N2O3 and a molecular weight of 299.54 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]ethyl 2-chloroacetate.
| Compound Name | 2-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]ethyl 2-chloroacetate |
|---|---|
| PubChem CID | 54333779 |
| Molecular Formula | C9H9Cl3N2O3 |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 2-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]ethyl 2-chloroacetate |
| SMILES | Nc1nc(OCCOC(=O)CCl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N2O3/c10-4-7(15)16-1-2-17-9-6(12)3-5(11)8(13)14-9/h3H,1-2,4H2,(H2,13,14) |
| InChIKey | TTZZOJHSCDTYOZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|