C9H8ClF3N2O3 — CID 18923770
methyl 2-[[6-amino-5-chloro-3-(trifluoromethyl)-2-pyridinyl]oxy]acetate (PubChem CID 18923770) has the molecular formula C9H8ClF3N2O3 and a molecular weight of 284.62 g/mol. Its IUPAC name is methyl 2-[[6-amino-5-chloro-3-(trifluoromethyl)-2-pyridinyl]oxy]acetate.
| Compound Name | methyl 2-[[6-amino-5-chloro-3-(trifluoromethyl)-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 18923770 |
| Molecular Formula | C9H8ClF3N2O3 |
| Molecular Weight | 284.62 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | methyl 2-[[6-amino-5-chloro-3-(trifluoromethyl)-2-pyridinyl]oxy]acetate |
| SMILES | COC(=O)COc1nc(N)c(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C9H8ClF3N2O3/c1-17-6(16)3-18-8-4(9(11,12)13)2-5(10)7(14)15-8/h2H,3H2,1H3,(H2,14,15) |
| InChIKey | YIMBAGIYPQLGCV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |