C10H8Cl2N2O — CID 168529155
(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidenehydrazine (PubChem CID 168529155) has the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. Its IUPAC name is (3,5-dichloro-4-prop-2-ynoxyphenyl)methylidenehydrazine.
| Compound Name | (3,5-dichloro-4-prop-2-ynoxyphenyl)methylidenehydrazine |
|---|---|
| PubChem CID | 168529155 |
| Molecular Formula | C10H8Cl2N2O |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (3,5-dichloro-4-prop-2-ynoxyphenyl)methylidenehydrazine |
| SMILES | C#CCOc1c(Cl)cc(C=NN)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O/c1-2-3-15-10-8(11)4-7(6-14-13)5-9(10)12/h1,4-6H,3,13H2 |
| InChIKey | BXITWDJINXXCJE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|