C15H15Cl2N3O3 — CID 8989397
N'-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-N-propyloxamide (PubChem CID 8989397) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N'-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-N-propyloxamide.
| Compound Name | N'-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-N-propyloxamide |
|---|---|
| PubChem CID | 8989397 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N'-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-N-propyloxamide |
| SMILES | C#CCOc1c(Cl)cc(/C=N\NC(=O)C(=O)NCCC)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O3/c1-3-5-18-14(21)15(22)20-19-9-10-7-11(16)13(12(17)8-10)23-6-4-2/h2,7-9H,3,5-6H2,1H3,(H,18,21)(H,20,22)/b19-9- |
| InChIKey | DLDYMWODXWKMAM-OCKHKDLRSA-N |
| XLogP | 1.98 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|