C21H18Cl3N3O4 — CID 3553064
N'-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(3,4-dichlorophenyl)propanediamide (PubChem CID 3553064) has the molecular formula C21H18Cl3N3O4 and a molecular weight of 482.75 g/mol. Its IUPAC name is N'-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(3,4-dichlorophenyl)propanediamide.
| Compound Name | N'-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(3,4-dichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 3553064 |
| Molecular Formula | C21H18Cl3N3O4 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N'-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]-N-(3,4-dichlorophenyl)propanediamide |
| SMILES | C#CCOc1c(Cl)cc(C=NNC(=O)CC(=O)Nc2ccc(Cl)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C21H18Cl3N3O4/c1-3-7-31-21-17(24)8-13(9-18(21)30-4-2)12-25-27-20(29)11-19(28)26-14-5-6-15(22)16(23)10-14/h1,5-6,8-10,12H,4,7,11H2,2H3,(H,26,28)(H,27,29) |
| InChIKey | MNNXIKYZMSGROO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|