C11H13N3O2 — CID 80859183
4-(furan-2-ylmethoxy)-N,5-dimethylpyrimidin-2-amine (PubChem CID 80859183) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(furan-2-ylmethoxy)-N,5-dimethylpyrimidin-2-amine.
| Compound Name | 4-(furan-2-ylmethoxy)-N,5-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80859183 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(furan-2-ylmethoxy)-N,5-dimethylpyrimidin-2-amine |
| SMILES | CNc1ncc(C)c(OCc2ccco2)n1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-6-13-11(12-2)14-10(8)16-7-9-4-3-5-15-9/h3-6H,7H2,1-2H3,(H,12,13,14) |
| InChIKey | BHTBNYBZQKNZRU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |