C12H24N6 — CID 144555996
ethane;2-methylbutan-1-amine;7H-purin-6-amine (PubChem CID 144555996) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is ethane;2-methylbutan-1-amine;7H-purin-6-amine.
| Compound Name | ethane;2-methylbutan-1-amine;7H-purin-6-amine |
|---|---|
| PubChem CID | 144555996 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | ethane;2-methylbutan-1-amine;7H-purin-6-amine |
| SMILES | CC.CCC(C)CN.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.C5H13N.C2H6/c6-4-3-5(9-1-7-3)10-2-8-4;1-3-5(2)4-6;1-2/h1-2H,(H3,6,7,8,9,10);5H,3-4,6H2,1-2H3;1-2H3 |
| InChIKey | AYMYDXINBXMQNA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |