C9H18N2O6 — CID 87251184
(2S)-2,6-diaminohexanoic acid;propanedioic acid (PubChem CID 87251184) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;propanedioic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;propanedioic acid |
|---|---|
| PubChem CID | 87251184 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;propanedioic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)CC(=O)O |
| InChI | InChI=1S/C6H14N2O2.C3H4O4/c7-4-2-1-3-5(8)6(9)10;4-2(5)1-3(6)7/h5H,1-4,7-8H2,(H,9,10);1H2,(H,4,5)(H,6,7)/t5-;/m0./s1 |
| InChIKey | PRNNJQZYMUNUOM-JEDNCBNOSA-N |
| XLogP | -0.93 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|