C13H7N3O4 — CID 154382496
1,2-dinitrophenanthridine (PubChem CID 154382496) has the molecular formula C13H7N3O4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 1,2-dinitrophenanthridine.
| Compound Name | 1,2-dinitrophenanthridine |
|---|---|
| PubChem CID | 154382496 |
| Molecular Formula | C13H7N3O4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1,2-dinitrophenanthridine |
| SMILES | O=[N+]([O-])c1ccc2ncc3ccccc3c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H7N3O4/c17-15(18)11-6-5-10-12(13(11)16(19)20)9-4-2-1-3-8(9)7-14-10/h1-7H |
| InChIKey | ZLOYOMKBXIZYQH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|