C20H12N2O3 — CID 141329135
5-(4-nitrophenyl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one (PubChem CID 141329135) has the molecular formula C20H12N2O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one.
| Compound Name | 5-(4-nitrophenyl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
|---|---|
| PubChem CID | 141329135 |
| Molecular Formula | C20H12N2O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-(4-nitrophenyl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
| SMILES | O=c1c2ccccc2ccc2ncc(-c3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C20H12N2O3/c23-20-17-4-2-1-3-14(17)7-10-19-18(20)11-15(12-21-19)13-5-8-16(9-6-13)22(24)25/h1-12H |
| InChIKey | AORNZUNCSBOXPN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|