C25H14Cl2N2O2 — CID 44613757
3-(2,4-dichlorophenyl)-1-(4-nitrophenyl)benzo[f]quinoline (PubChem CID 44613757) has the molecular formula C25H14Cl2N2O2 and a molecular weight of 445.31 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(4-nitrophenyl)benzo[f]quinoline.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(4-nitrophenyl)benzo[f]quinoline |
|---|---|
| PubChem CID | 44613757 |
| Molecular Formula | C25H14Cl2N2O2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(4-nitrophenyl)benzo[f]quinoline |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3ccc(Cl)cc3Cl)nc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C25H14Cl2N2O2/c26-17-8-11-20(22(27)13-17)24-14-21(16-5-9-18(10-6-16)29(30)31)25-19-4-2-1-3-15(19)7-12-23(25)28-24/h1-14H |
| InChIKey | NNWSMJQJGDLWCX-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|