C23H12Cl2N4O3S — CID 5176488
2-(2,4-dichlorophenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide (PubChem CID 5176488) has the molecular formula C23H12Cl2N4O3S and a molecular weight of 495.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5176488 |
| Molecular Formula | C23H12Cl2N4O3S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C23H12Cl2N4O3S/c24-12-5-7-15(17(25)9-12)20-11-16(14-3-1-2-4-18(14)26-20)22(30)28-23-27-19-8-6-13(29(31)32)10-21(19)33-23/h1-11H,(H,27,28,30) |
| InChIKey | HHQWXLMNBUJPQD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|