C22H13Cl2N3O3 — CID 3565307
2-(2,4-dichlorophenyl)-N-(2-nitrophenyl)quinoline-4-carboxamide (PubChem CID 3565307) has the molecular formula C22H13Cl2N3O3 and a molecular weight of 438.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3565307 |
| Molecular Formula | C22H13Cl2N3O3 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-nitrophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H13Cl2N3O3/c23-13-9-10-15(17(24)11-13)20-12-16(14-5-1-2-6-18(14)25-20)22(28)26-19-7-3-4-8-21(19)27(29)30/h1-12H,(H,26,28) |
| InChIKey | AFJJDPGDUMKWLZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|