C19H12ClN5 — CID 71593631
2-chloro-4-methyl-14-phenyl-7,9,13,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11(15),12,16-octaene (PubChem CID 71593631) has the molecular formula C19H12ClN5 and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-chloro-4-methyl-14-phenyl-7,9,13,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11(15),12,16-octaene.
| Compound Name | 2-chloro-4-methyl-14-phenyl-7,9,13,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11(15),12,16-octaene |
|---|---|
| PubChem CID | 71593631 |
| Molecular Formula | C19H12ClN5 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-chloro-4-methyl-14-phenyl-7,9,13,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11(15),12,16-octaene |
| SMILES | Cc1ccnc2nc3c(cnc4c3cnn4-c3ccccc3)c(Cl)c12 |
| InChI | InChI=1S/C19H12ClN5/c1-11-7-8-21-18-15(11)16(20)13-9-22-19-14(17(13)24-18)10-23-25(19)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | ZXXGUAKJYVRNJX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|