C14H7Cl2N5 — CID 10064325
10,13-dichloro-4-phenyl-2,4,5,11,12-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene (PubChem CID 10064325) has the molecular formula C14H7Cl2N5 and a molecular weight of 316.15 g/mol. Its IUPAC name is 10,13-dichloro-4-phenyl-2,4,5,11,12-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene.
| Compound Name | 10,13-dichloro-4-phenyl-2,4,5,11,12-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 10064325 |
| Molecular Formula | C14H7Cl2N5 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 10,13-dichloro-4-phenyl-2,4,5,11,12-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene |
| SMILES | Clc1nnc(Cl)c2nc3c(cnn3-c3ccccc3)cc12 |
| InChI | InChI=1S/C14H7Cl2N5/c15-12-10-6-8-7-17-21(9-4-2-1-3-5-9)14(8)18-11(10)13(16)20-19-12/h1-7H |
| InChIKey | FLIXNNPIZBBTCC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |