C31H24N2 — CID 11796602
(1R,8S)-1,3,5-triphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene (PubChem CID 11796602) has the molecular formula C31H24N2 and a molecular weight of 424.55 g/mol. Its IUPAC name is (1R,8S)-1,3,5-triphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene.
| Compound Name | (1R,8S)-1,3,5-triphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene |
|---|---|
| PubChem CID | 11796602 |
| Molecular Formula | C31H24N2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (1R,8S)-1,3,5-triphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene |
| SMILES | c1ccc(-c2nn(-c3ccccc3)c3c2[C@@]2(c4ccccc4)C[C@@H](C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H24N2/c1-4-12-22(13-5-1)30-29-28(33(32-30)25-16-8-3-9-17-25)20-23-21-31(29,24-14-6-2-7-15-24)27-19-11-10-18-26(23)27/h1-19,23H,20-21H2/t23-,31-/m1/s1 |
| InChIKey | AITQBZCJUJNHGV-SLGOVJDISA-N |
| XLogP | 6.92 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |