C34H24BrN3O4 — CID 102297870
5'-bromo-11a-hydroxy-1'-methyl-8,10-diphenylspiro[6a,11-dihydrochromeno[3,4-f]indazole-7,3'-indole]-2',6-dione (PubChem CID 102297870) has the molecular formula C34H24BrN3O4 and a molecular weight of 618.49 g/mol. Its IUPAC name is 5'-bromo-11a-hydroxy-1'-methyl-8,10-diphenylspiro[6a,11-dihydrochromeno[3,4-f]indazole-7,3'-indole]-2',6-dione.
| Compound Name | 5'-bromo-11a-hydroxy-1'-methyl-8,10-diphenylspiro[6a,11-dihydrochromeno[3,4-f]indazole-7,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 102297870 |
| Molecular Formula | C34H24BrN3O4 |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 5'-bromo-11a-hydroxy-1'-methyl-8,10-diphenylspiro[6a,11-dihydrochromeno[3,4-f]indazole-7,3'-indole]-2',6-dione |
| SMILES | CN1C(=O)C2(c3cc(Br)ccc31)c1c(-c3ccccc3)nn(-c3ccccc3)c1CC1(O)c3ccccc3OC(=O)C12 |
| InChI | InChI=1S/C34H24BrN3O4/c1-37-25-17-16-21(35)18-24(25)34(32(37)40)28-26(19-33(41)23-14-8-9-15-27(23)42-31(39)30(33)34)38(22-12-6-3-7-13-22)36-29(28)20-10-4-2-5-11-20/h2-18,30,41H,19H2,1H3 |
| InChIKey | ZZEGMFLFWZTPOQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|