C33H22BrN5O2 — CID 136811997
1'-bromo-8-methyl-13,15-diphenylspiro[8,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene-11,3'-indole]-2',9-dione (PubChem CID 136811997) has the molecular formula C33H22BrN5O2 and a molecular weight of 600.48 g/mol. Its IUPAC name is 1'-bromo-8-methyl-13,15-diphenylspiro[8,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene-11,3'-indole]-2',9-dione.
| Compound Name | 1'-bromo-8-methyl-13,15-diphenylspiro[8,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene-11,3'-indole]-2',9-dione |
|---|---|
| PubChem CID | 136811997 |
| Molecular Formula | C33H22BrN5O2 |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | 1'-bromo-8-methyl-13,15-diphenylspiro[8,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene-11,3'-indole]-2',9-dione |
| SMILES | Cn1c(=O)c2c(c3ccccc31)Nc1c(c(-c3ccccc3)nn1-c1ccccc1)C21C(=O)N(Br)c2ccccc21 |
| InChI | InChI=1S/C33H22BrN5O2/c1-37-24-18-10-8-16-22(24)29-27(31(37)40)33(23-17-9-11-19-25(23)38(34)32(33)41)26-28(20-12-4-2-5-13-20)36-39(30(26)35-29)21-14-6-3-7-15-21/h2-19,35H,1H3 |
| InChIKey | UERYODFELQFFIH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|