C18H12N2OS — CID 134113755
1,3-diphenylthieno[3,4-d]pyridazin-4-one (PubChem CID 134113755) has the molecular formula C18H12N2OS and a molecular weight of 304.37 g/mol. Its IUPAC name is 1,3-diphenylthieno[3,4-d]pyridazin-4-one.
| Compound Name | 1,3-diphenylthieno[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 134113755 |
| Molecular Formula | C18H12N2OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1,3-diphenylthieno[3,4-d]pyridazin-4-one |
| SMILES | O=c1c2cscc2c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H12N2OS/c21-18-16-12-22-11-15(16)17(13-7-3-1-4-8-13)19-20(18)14-9-5-2-6-10-14/h1-12H |
| InChIKey | BKOSERTUILZWER-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |