C15H14N2OS — CID 134113756
1-phenyl-3-propylthieno[3,4-d]pyridazin-4-one (PubChem CID 134113756) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-phenyl-3-propylthieno[3,4-d]pyridazin-4-one.
| Compound Name | 1-phenyl-3-propylthieno[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 134113756 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-phenyl-3-propylthieno[3,4-d]pyridazin-4-one |
| SMILES | CCCn1nc(-c2ccccc2)c2cscc2c1=O |
| InChI | InChI=1S/C15H14N2OS/c1-2-8-17-15(18)13-10-19-9-12(13)14(16-17)11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3 |
| InChIKey | AKZCFTFGIMOPBB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |