C17H13Cl3N2O — CID 142711544
6,7-dichloro-2-(3-chloropropyl)-4-phenylphthalazin-1-one (PubChem CID 142711544) has the molecular formula C17H13Cl3N2O and a molecular weight of 367.66 g/mol. Its IUPAC name is 6,7-dichloro-2-(3-chloropropyl)-4-phenylphthalazin-1-one.
| Compound Name | 6,7-dichloro-2-(3-chloropropyl)-4-phenylphthalazin-1-one |
|---|---|
| PubChem CID | 142711544 |
| Molecular Formula | C17H13Cl3N2O |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 6,7-dichloro-2-(3-chloropropyl)-4-phenylphthalazin-1-one |
| SMILES | O=c1c2cc(Cl)c(Cl)cc2c(-c2ccccc2)nn1CCCCl |
| InChI | InChI=1S/C17H13Cl3N2O/c18-7-4-8-22-17(23)13-10-15(20)14(19)9-12(13)16(21-22)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | NFMCLHWGUHTTTH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|