C18H14N2O3 — CID 71319561
5-(3-nitrophenyl)-1,3,4,5-tetrahydroindeno[1,2-b]pyridin-2-one (PubChem CID 71319561) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-1,3,4,5-tetrahydroindeno[1,2-b]pyridin-2-one.
| Compound Name | 5-(3-nitrophenyl)-1,3,4,5-tetrahydroindeno[1,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 71319561 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-(3-nitrophenyl)-1,3,4,5-tetrahydroindeno[1,2-b]pyridin-2-one |
| SMILES | O=C1CCC2=C(N1)c1ccccc1C2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N2O3/c21-16-9-8-15-17(11-4-3-5-12(10-11)20(22)23)13-6-1-2-7-14(13)18(15)19-16/h1-7,10,17H,8-9H2,(H,19,21) |
| InChIKey | FTYHZQGYDSXBHZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|