C24H16N2O4 — CID 139215349
3-(3-nitrophenyl)-6-oxa-9-azapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),4(8),11,14,16,18-heptaen-7-one (PubChem CID 139215349) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-6-oxa-9-azapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),4(8),11,14,16,18-heptaen-7-one.
| Compound Name | 3-(3-nitrophenyl)-6-oxa-9-azapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),4(8),11,14,16,18-heptaen-7-one |
|---|---|
| PubChem CID | 139215349 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-(3-nitrophenyl)-6-oxa-9-azapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),4(8),11,14,16,18-heptaen-7-one |
| SMILES | O=C1OCC2=C1Nc1ccc3c(c1C2c1cccc([N+](=O)[O-])c1)Cc1ccccc1-3 |
| InChI | InChI=1S/C24H16N2O4/c27-24-23-19(12-30-24)21(14-5-3-6-15(10-14)26(28)29)22-18-11-13-4-1-2-7-16(13)17(18)8-9-20(22)25-23/h1-10,21,25H,11-12H2 |
| InChIKey | VIEYHGMKPOEYTR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|