C18H14N2O4 — CID 12003198
7-methyl-9-(3-nitrophenyl)-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one (PubChem CID 12003198) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 7-methyl-9-(3-nitrophenyl)-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one.
| Compound Name | 7-methyl-9-(3-nitrophenyl)-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 12003198 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 7-methyl-9-(3-nitrophenyl)-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one |
| SMILES | Cc1ccc2c(c1)C(c1cccc([N+](=O)[O-])c1)C1=C(COC1=O)N2 |
| InChI | InChI=1S/C18H14N2O4/c1-10-5-6-14-13(7-10)16(17-15(19-14)9-24-18(17)21)11-3-2-4-12(8-11)20(22)23/h2-8,16,19H,9H2,1H3 |
| InChIKey | RGCKMNXOUXFJPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|