C24H21N3O3 — CID 4583101
9,9-dimethyl-12-(3-nitrophenyl)-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one (PubChem CID 4583101) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 9,9-dimethyl-12-(3-nitrophenyl)-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one.
| Compound Name | 9,9-dimethyl-12-(3-nitrophenyl)-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 4583101 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 9,9-dimethyl-12-(3-nitrophenyl)-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccc3ncccc3c1C2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N3O3/c1-24(2)12-19-23(20(28)13-24)21(14-5-3-6-15(11-14)27(29)30)22-16-7-4-10-25-17(16)8-9-18(22)26-19/h3-11,21,26H,12-13H2,1-2H3 |
| InChIKey | IONJAPBGVQCVFD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|