C23H20BrN3O — CID 140930926
12-(6-bromo-3-pyridinyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one (PubChem CID 140930926) has the molecular formula C23H20BrN3O and a molecular weight of 434.34 g/mol. Its IUPAC name is 12-(6-bromo-3-pyridinyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one.
| Compound Name | 12-(6-bromo-3-pyridinyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 140930926 |
| Molecular Formula | C23H20BrN3O |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 12-(6-bromo-3-pyridinyl)-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[b][4,7]phenanthrolin-11-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccc3ncccc3c1C2c1ccc(Br)nc1 |
| InChI | InChI=1S/C23H20BrN3O/c1-23(2)10-17-22(18(28)11-23)20(13-5-8-19(24)26-12-13)21-14-4-3-9-25-15(14)6-7-16(21)27-17/h3-9,12,20,27H,10-11H2,1-2H3 |
| InChIKey | PELJKMVPZMMFNX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|