C27H22N2O6 — CID 5227652
dibenzyl 4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 5227652) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is dibenzyl 4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dibenzyl 4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 5227652 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | dibenzyl 4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)C1=CNC=C(C(=O)OCc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H22N2O6/c30-26(34-17-19-8-3-1-4-9-19)23-15-28-16-24(27(31)35-18-20-10-5-2-6-11-20)25(23)21-12-7-13-22(14-21)29(32)33/h1-16,25,28H,17-18H2 |
| InChIKey | GMDAPUBOFJXRMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|