C11H13ClN2O4 — CID 56972023
(3R,4S)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 56972023) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol. Its IUPAC name is (3R,4S)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R,4S)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 56972023 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (3R,4S)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H]1CNC[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O4.ClH/c14-11(15)10-6-12-5-9(10)7-2-1-3-8(4-7)13(16)17;/h1-4,9-10,12H,5-6H2,(H,14,15);1H/t9-,10+;/m1./s1 |
| InChIKey | VBJLKZLLJQSJJX-UXQCFNEQSA-N |
| XLogP | 1.40 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|