C10H11N3O3 — CID 139349738
cis-(1R,2S)-2-(3-nitrophenyl)cyclopropane-1-carbohydrazide (PubChem CID 139349738) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-nitrophenyl)cyclopropane-1-carbohydrazide.
| Compound Name | cis-(1R,2S)-2-(3-nitrophenyl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 139349738 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | cis-(1R,2S)-2-(3-nitrophenyl)cyclopropane-1-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1C[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11N3O3/c11-12-10(14)9-5-8(9)6-2-1-3-7(4-6)13(15)16/h1-4,8-9H,5,11H2,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | CPYDKEPTIHCBIW-RKDXNWHRSA-N |
| XLogP | 0.69 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|