C18H14FN5O3 — CID 167869470
trans-(1S,2S)-2-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclopropane-1-carboxamide (PubChem CID 167869470) has the molecular formula C18H14FN5O3 and a molecular weight of 367.34 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167869470 |
| Molecular Formula | C18H14FN5O3 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | trans-(1S,2S)-2-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1n[nH]c(-c2cccc([N+](=O)[O-])c2)n1)[C@H]1C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C18H14FN5O3/c19-12-5-1-3-10(7-12)14-9-15(14)17(25)21-18-20-16(22-23-18)11-4-2-6-13(8-11)24(26)27/h1-8,14-15H,9H2,(H2,20,21,22,23,25)/t14-,15+/m1/s1 |
| InChIKey | JFAXIPAGXOZAAX-CABCVRRESA-N |
| XLogP | 3.26 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|