C19H16FN5O3 — CID 167989713
3-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclobutane-1-carboxamide (PubChem CID 167989713) has the molecular formula C19H16FN5O3 and a molecular weight of 381.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclobutane-1-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167989713 |
| Molecular Formula | C19H16FN5O3 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[5-(3-nitrophenyl)-1H-1,2,4-triazol-3-yl]cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1n[nH]c(-c2cccc([N+](=O)[O-])c2)n1)C1CC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H16FN5O3/c20-15-5-1-3-11(9-15)13-7-14(8-13)18(26)22-19-21-17(23-24-19)12-4-2-6-16(10-12)25(27)28/h1-6,9-10,13-14H,7-8H2,(H2,21,22,23,24,26) |
| InChIKey | SMHRQNIMRNUQAS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|